C15H24Cl3NO7 — CID 134811735
2,2,2-trichloroethyl N-[(2R,3R,4R,5S,6R)-2-cyclohexyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate (PubChem CID 134811735) has the molecular formula C15H24Cl3NO7 and a molecular weight of 436.72 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2R,3R,4R,5S,6R)-2-cyclohexyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2R,3R,4R,5S,6R)-2-cyclohexyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 134811735 |
| Molecular Formula | C15H24Cl3NO7 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2R,3R,4R,5S,6R)-2-cyclohexyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
| SMILES | O=C(N[C@H]1[C@H](OC2CCCCC2)O[C@H](CO)[C@@H](O)[C@@H]1O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H24Cl3NO7/c16-15(17,18)7-24-14(23)19-10-12(22)11(21)9(6-20)26-13(10)25-8-4-2-1-3-5-8/h8-13,20-22H,1-7H2,(H,19,23)/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | YUMVUHSRYKVUOO-SYLRKERUSA-N |
| XLogP | 1.24 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|