C33H34NO10P — CID 102318736
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-diphenylphosphanylbenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 102318736) has the molecular formula C33H34NO10P and a molecular weight of 635.61 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-diphenylphosphanylbenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-diphenylphosphanylbenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102318736 |
| Molecular Formula | C33H34NO10P |
| Molecular Weight | 635.61 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-diphenylphosphanylbenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H34NO10P/c1-20(35)40-19-27-30(41-21(2)36)31(42-22(3)37)29(33(44-27)43-23(4)38)34-32(39)26-17-11-12-18-28(26)45(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-18,27,29-31,33H,19H2,1-4H3,(H,34,39)/t27-,29-,30-,31-,33+/m1/s1 |
| InChIKey | ZDKSETAWPRAYNN-PTXWAVMNSA-N |
| XLogP | 2.26 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|