C19H24N2O13 — CID 163136637
N-hydroxy-5-[[(2S,3S,4R,5R,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]carbamoyl]furan-2-amine oxide (PubChem CID 163136637) has the molecular formula C19H24N2O13 and a molecular weight of 488.40 g/mol. Its IUPAC name is N-hydroxy-5-[[(2S,3S,4R,5R,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]carbamoyl]furan-2-amine oxide.
| Compound Name | N-hydroxy-5-[[(2S,3S,4R,5R,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]carbamoyl]furan-2-amine oxide |
|---|---|
| PubChem CID | 163136637 |
| Molecular Formula | C19H24N2O13 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-hydroxy-5-[[(2S,3S,4R,5R,6S)-2,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-3-yl]carbamoyl]furan-2-amine oxide |
| SMILES | CC(=O)OC[C@@H]1O[C@@H](OC(C)=O)[C@@H](NC(=O)c2ccc([NH+]([O-])O)o2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24N2O13/c1-8(22)29-7-13-16(30-9(2)23)17(31-10(3)24)15(19(34-13)32-11(4)25)20-18(26)12-5-6-14(33-12)21(27)28/h5-6,13,15-17,19,21,27H,7H2,1-4H3,(H,20,26)/t13-,15-,16-,17+,19+/m0/s1 |
| InChIKey | IESGSGOUDSPVLG-VNDHCKRVSA-N |
| XLogP | -1.50 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|