C15H22O9Se — CID 85301719
(3,4,5-triacetyloxy-6-methylselanyloxan-2-yl)methyl acetate (PubChem CID 85301719) has the molecular formula C15H22O9Se and a molecular weight of 425.29 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-methylselanyloxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-methylselanyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 85301719 |
| Molecular Formula | C15H22O9Se |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (3,4,5-triacetyloxy-6-methylselanyloxan-2-yl)methyl acetate |
| SMILES | C[Se]C1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C15H22O9Se/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3 |
| InChIKey | JABNVMNBWDYFKR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|