C25H28Cl3NO7S — CID 11114616
[(2S,3R,4R,5S,6R)-5-hydroxy-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] acetate (PubChem CID 11114616) has the molecular formula C25H28Cl3NO7S and a molecular weight of 592.93 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-5-hydroxy-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6R)-5-hydroxy-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11114616 |
| Molecular Formula | C25H28Cl3NO7S |
| Molecular Weight | 592.93 g/mol |
| Exact Mass | 591.07 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-5-hydroxy-2-(4-methylphenyl)sulfanyl-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](COCc2ccccc2)O[C@@H](Sc2ccc(C)cc2)[C@@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H28Cl3NO7S/c1-15-8-10-18(11-9-15)37-23-20(29-24(32)34-14-25(26,27)28)22(35-16(2)30)21(31)19(36-23)13-33-12-17-6-4-3-5-7-17/h3-11,19-23,31H,12-14H2,1-2H3,(H,29,32)/t19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | HQWPDDOMARZBCI-JLMDMGSGSA-N |
| XLogP | 4.79 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.93 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|