C39H48Cl3NO8S — CID 11239786
[(2R,3S,4R,5R,6R)-3-hydroxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)(613C)oxan-4-yl] (3R)-3-phenylmethoxydecanoate (PubChem CID 11239786) has the molecular formula C39H48Cl3NO8S and a molecular weight of 798.23 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3-hydroxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)(613C)oxan-4-yl] (3R)-3-phenylmethoxydecanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3-hydroxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)(613C)oxan-4-yl] (3R)-3-phenylmethoxydecanoate |
|---|---|
| PubChem CID | 11239786 |
| Molecular Formula | C39H48Cl3NO8S |
| Molecular Weight | 798.23 g/mol |
| Exact Mass | 796.22 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3-hydroxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-5-(2,2,2-trichloroethoxycarbonylamino)(613C)oxan-4-yl] (3R)-3-phenylmethoxydecanoate |
| SMILES | CCCCCCC[C@H](CC(=O)O[C@H]1[C@H](O)[C@@H](COCc2ccccc2)O[13C@H](Sc2ccccc2)[C@@H]1NC(=O)OCC(Cl)(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C39H48Cl3NO8S/c1-2-3-4-5-13-20-30(48-25-29-18-11-7-12-19-29)23-33(44)51-36-34(43-38(46)49-27-39(40,41)42)37(52-31-21-14-8-15-22-31)50-32(35(36)45)26-47-24-28-16-9-6-10-17-28/h6-12,14-19,21-22,30,32,34-37,45H,2-5,13,20,23-27H2,1H3,(H,43,46)/t30-,32-,34-,35-,36-,37-/m1/s1/i37+1 |
| InChIKey | XSERQBNTYSZNLD-QTUPDBOASA-N |
| XLogP | 8.79 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.23 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|