C21H21N3O5Se — CID 10961745
[(4aR,6R,7S,8R,8aS)-7-azido-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 10961745) has the molecular formula C21H21N3O5Se and a molecular weight of 474.38 g/mol. Its IUPAC name is [(4aR,6R,7S,8R,8aS)-7-azido-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6R,7S,8R,8aS)-7-azido-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 10961745 |
| Molecular Formula | C21H21N3O5Se |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | [(4aR,6R,7S,8R,8aS)-7-azido-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](N=[N+]=[N-])[C@@H]([Se]c2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C21H21N3O5Se/c1-13(25)27-19-17(23-24-22)21(30-15-10-6-3-7-11-15)28-16-12-26-20(29-18(16)19)14-8-4-2-5-9-14/h2-11,16-21H,12H2,1H3/t16-,17+,18-,19-,20?,21-/m1/s1 |
| InChIKey | SAJLLEUWGDFGAG-FFKRPEIQSA-N |
| XLogP | 2.47 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|