C33H38O6 — CID 10951566
(2S,4aR,7R,8S,8aS)-6-cyclohexyloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10951566) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is (2S,4aR,7R,8S,8aS)-6-cyclohexyloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2S,4aR,7R,8S,8aS)-6-cyclohexyloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10951566 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (2S,4aR,7R,8S,8aS)-6-cyclohexyloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | c1ccc(CO[C@H]2[C@H]3O[C@@H](c4ccccc4)OC[C@H]3OC(OC3CCCCC3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H38O6/c1-5-13-24(14-6-1)21-34-30-29-28(23-36-32(39-29)26-17-9-3-10-18-26)38-33(37-27-19-11-4-12-20-27)31(30)35-22-25-15-7-2-8-16-25/h1-3,5-10,13-18,27-33H,4,11-12,19-23H2/t28-,29+,30+,31-,32+,33?/m1/s1 |
| InChIKey | FZGKUFXRDWSJTC-IYEYJWHWSA-N |
| XLogP | 6.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |