C32H46O5S — CID 130360680
(6S,8aR)-7,8-dibutoxy-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 130360680) has the molecular formula C32H46O5S and a molecular weight of 542.78 g/mol. Its IUPAC name is (6S,8aR)-7,8-dibutoxy-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6S,8aR)-7,8-dibutoxy-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 130360680 |
| Molecular Formula | C32H46O5S |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (6S,8aR)-7,8-dibutoxy-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCOC1C(OCCCC)[C@H](Sc2cc(C(C)(C)C)ccc2C)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C32H46O5S/c1-7-9-18-33-28-27-25(21-35-30(37-27)23-14-12-11-13-15-23)36-31(29(28)34-19-10-8-2)38-26-20-24(32(4,5)6)17-16-22(26)3/h11-17,20,25,27-31H,7-10,18-19,21H2,1-6H3/t25?,27-,28?,29?,30?,31+/m1/s1 |
| InChIKey | LOHFLVJLIUASCW-WYRGLLQMSA-N |
| XLogP | 7.59 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|