C14H26N4O3 — CID 174181019
N-[(2S,3R,5S)-5-azido-6-methyl-2-propan-2-yl-4-propan-2-yloxyoxan-3-yl]acetamide (PubChem CID 174181019) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[(2S,3R,5S)-5-azido-6-methyl-2-propan-2-yl-4-propan-2-yloxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,5S)-5-azido-6-methyl-2-propan-2-yl-4-propan-2-yloxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 174181019 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[(2S,3R,5S)-5-azido-6-methyl-2-propan-2-yl-4-propan-2-yloxyoxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(OC(C)C)[C@@H](N=[N+]=[N-])C(C)O[C@H]1C(C)C |
| InChI | InChI=1S/C14H26N4O3/c1-7(2)13-12(16-10(6)19)14(20-8(3)4)11(17-18-15)9(5)21-13/h7-9,11-14H,1-6H3,(H,16,19)/t9?,11-,12+,13-,14?/m0/s1 |
| InChIKey | ICVXFQHZUOADQL-WTUGGMQLSA-N |
| XLogP | 2.41 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|