C16H29N5O4 — CID 163202627
ethyl (3S,4R,5S)-4-acetamido-5-amino-2-azido-3-pentan-3-yloxycyclohexane-1-carboxylate (PubChem CID 163202627) has the molecular formula C16H29N5O4 and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-4-acetamido-5-amino-2-azido-3-pentan-3-yloxycyclohexane-1-carboxylate.
| Compound Name | ethyl (3S,4R,5S)-4-acetamido-5-amino-2-azido-3-pentan-3-yloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163202627 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | ethyl (3S,4R,5S)-4-acetamido-5-amino-2-azido-3-pentan-3-yloxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C[C@H](N)[C@@H](NC(C)=O)[C@H](OC(CC)CC)C1N=[N+]=[N-] |
| InChI | InChI=1S/C16H29N5O4/c1-5-10(6-2)25-15-13(20-21-18)11(16(23)24-7-3)8-12(17)14(15)19-9(4)22/h10-15H,5-8,17H2,1-4H3,(H,19,22)/t11?,12-,13?,14+,15+/m0/s1 |
| InChIKey | GSFIWDGFHNAUFU-FWJBWGTRSA-N |
| XLogP | 1.65 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|