C9H13N7O5 — CID 138984313
ethyl (3S)-4,5-diazido-3-hydroxy-2-nitrocyclohexane-1-carboxylate (PubChem CID 138984313) has the molecular formula C9H13N7O5 and a molecular weight of 299.25 g/mol. Its IUPAC name is ethyl (3S)-4,5-diazido-3-hydroxy-2-nitrocyclohexane-1-carboxylate.
| Compound Name | ethyl (3S)-4,5-diazido-3-hydroxy-2-nitrocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 138984313 |
| Molecular Formula | C9H13N7O5 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | ethyl (3S)-4,5-diazido-3-hydroxy-2-nitrocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(N=[N+]=[N-])C(N=[N+]=[N-])[C@H](O)C1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N7O5/c1-2-21-9(18)4-3-5(12-14-10)6(13-15-11)8(17)7(4)16(19)20/h4-8,17H,2-3H2,1H3/t4?,5?,6?,7?,8-/m0/s1 |
| InChIKey | GJKBUWGCFDHKGM-WNBHMGEASA-N |
| XLogP | 0.93 |
| TPSA | 187.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|