C8H15BN4O3 — CID 59091281
[(2R,3R)-3-azido-2-ethoxycarbonylpyrrolidin-1-yl]-methylborinic acid (PubChem CID 59091281) has the molecular formula C8H15BN4O3 and a molecular weight of 226.04 g/mol. Its IUPAC name is [(2R,3R)-3-azido-2-ethoxycarbonylpyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(2R,3R)-3-azido-2-ethoxycarbonylpyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59091281 |
| Molecular Formula | C8H15BN4O3 |
| Molecular Weight | 226.04 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [(2R,3R)-3-azido-2-ethoxycarbonylpyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@H]1[C@H](N=[N+]=[N-])CCN1B(C)O |
| InChI | InChI=1S/C8H15BN4O3/c1-3-16-8(14)7-6(11-12-10)4-5-13(7)9(2)15/h6-7,15H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | AXXDPGZMYZFUJA-RNFRBKRXSA-N |
| XLogP | 0.41 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.04 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|