C9H15N3O3 — CID 129167727
cis-ethyl (1R,4S)-3-azido-4-hydroxycyclohexane-1-carboxylate (PubChem CID 129167727) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is cis-ethyl (1R,4S)-3-azido-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1R,4S)-3-azido-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129167727 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | cis-ethyl (1R,4S)-3-azido-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](O)C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H15N3O3/c1-2-15-9(14)6-3-4-8(13)7(5-6)11-12-10/h6-8,13H,2-5H2,1H3/t6-,7?,8+/m1/s1 |
| InChIKey | ZSEPOKOVRBPMOH-QUFPSDLASA-N |
| XLogP | 1.39 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|