C25H42O9 — CID 129288692
4-[[(3R,3aR,6S,6aR)-3-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-ethyl-4,7-dimethyl-5-propan-2-yloctanoic acid (PubChem CID 129288692) has the molecular formula C25H42O9 and a molecular weight of 486.60 g/mol. Its IUPAC name is 4-[[(3R,3aR,6S,6aR)-3-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-ethyl-4,7-dimethyl-5-propan-2-yloctanoic acid.
| Compound Name | 4-[[(3R,3aR,6S,6aR)-3-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-ethyl-4,7-dimethyl-5-propan-2-yloctanoic acid |
|---|---|
| PubChem CID | 129288692 |
| Molecular Formula | C25H42O9 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 4-[[(3R,3aR,6S,6aR)-3-(3-carboxypropanoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-ethyl-4,7-dimethyl-5-propan-2-yloctanoic acid |
| SMILES | CCC(C(C)C)C(C(C)C)C(C)(CCC(=O)O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H42O9/c1-7-16(14(2)3)22(15(4)5)25(6,11-10-20(28)29)34-18-13-32-23-17(12-31-24(18)23)33-21(30)9-8-19(26)27/h14-18,22-24H,7-13H2,1-6H3,(H,26,27)(H,28,29)/t16?,17-,18+,22?,23-,24-,25?/m1/s1 |
| InChIKey | GFLQINDGVPONHH-TZFMUMNISA-N |
| XLogP | 3.52 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |