C12H14FNO4S — CID 61314348
(1,1-dioxothiolan-3-yl) 3-amino-5-fluoro-4-methylbenzoate (PubChem CID 61314348) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) 3-amino-5-fluoro-4-methylbenzoate.
| Compound Name | (1,1-dioxothiolan-3-yl) 3-amino-5-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 61314348 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) 3-amino-5-fluoro-4-methylbenzoate |
| SMILES | Cc1c(N)cc(C(=O)OC2CCS(=O)(=O)C2)cc1F |
| InChI | InChI=1S/C12H14FNO4S/c1-7-10(13)4-8(5-11(7)14)12(15)18-9-2-3-19(16,17)6-9/h4-5,9H,2-3,6,14H2,1H3 |
| InChIKey | AHNUZDVSYTZNCB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|