About (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate
(5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate (PubChem CID 167046425) has the molecular formula C5H9FN2O7S2
and a molecular weight of 292.27 g/mol. Its IUPAC name is (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate.
Molecular Properties
| Compound Name | (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate |
| PubChem CID | 167046425 |
| Molecular Formula | C5H9FN2O7S2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate |
| SMILES | CS(=O)(=O)N(N)C(=O)OC1CS(=O)(=O)OC1F |
| InChI | InChI=1S/C5H9FN2O7S2/c1-16(10,11)8(7)5(9)14-3-2-17(12,13)15-4(3)6/h3-4H,2,7H2,1H3 |
| InChIKey | YTZCLIYMCIBVLQ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate?
The IUPAC name of (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate (CID 167046425) is (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate.
What is the SMILES notation for (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate?
The canonical SMILES for (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate is CS(=O)(=O)N(N)C(=O)OC1CS(=O)(=O)OC1F.
What is the InChIKey of (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate?
The InChIKey is YTZCLIYMCIBVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2O7S2/c1-16(10,11)8(7)5(9)14-3-2-17(12,13)15-4(3)6/h3-4H,2,7H2,1H3.
What are the key properties of (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate?
(5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate has a molecular weight of 292.27 g/mol, XLogP of -1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,2-dioxooxathiolan-4-yl) N-amino-N-methylsulfonylcarbamate is sourced from PubChem (CID 167046425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).