About (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate
(5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate (PubChem CID 90002327) has the molecular formula C7H13FO5S
and a molecular weight of 228.24 g/mol. Its IUPAC name is (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate.
Analyze (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate?
The IUPAC name of (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate (CID 90002327) is (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate.
What is the SMILES notation for (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate?
The canonical SMILES for (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate is CC(C)C(=O)OC1CS(O)(O)OC1F.
What is the InChIKey of (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate?
The InChIKey is VWZYBEYIEWEJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO5S/c1-4(2)7(9)12-5-3-14(10,11)13-6(5)8/h4-6,10-11H,3H2,1-2H3.
What are the key properties of (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate?
(5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate has a molecular weight of 228.24 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,2-dihydroxyoxathiolan-4-yl) 2-methylpropanoate is sourced from PubChem (CID 90002327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).