C12H18O10S2 — CID 155384273
bis(5-methyl-2,2-dioxooxathiolan-4-yl) 2-methylpropanedioate (PubChem CID 155384273) has the molecular formula C12H18O10S2 and a molecular weight of 386.40 g/mol. Its IUPAC name is bis(5-methyl-2,2-dioxooxathiolan-4-yl) 2-methylpropanedioate.
| Compound Name | bis(5-methyl-2,2-dioxooxathiolan-4-yl) 2-methylpropanedioate |
|---|---|
| PubChem CID | 155384273 |
| Molecular Formula | C12H18O10S2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | bis(5-methyl-2,2-dioxooxathiolan-4-yl) 2-methylpropanedioate |
| SMILES | CC(C(=O)OC1CS(=O)(=O)OC1C)C(=O)OC1CS(=O)(=O)OC1C |
| InChI | InChI=1S/C12H18O10S2/c1-6(11(13)19-9-4-23(15,16)21-7(9)2)12(14)20-10-5-24(17,18)22-8(10)3/h6-10H,4-5H2,1-3H3 |
| InChIKey | SFZLSVXJTYARSG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|