C10H12N2O7S2 — CID 167046313
(2,2-dioxooxathiolan-4-yl) N-amino-N-(benzenesulfonyl)carbamate (PubChem CID 167046313) has the molecular formula C10H12N2O7S2 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2,2-dioxooxathiolan-4-yl) N-amino-N-(benzenesulfonyl)carbamate.
| Compound Name | (2,2-dioxooxathiolan-4-yl) N-amino-N-(benzenesulfonyl)carbamate |
|---|---|
| PubChem CID | 167046313 |
| Molecular Formula | C10H12N2O7S2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (2,2-dioxooxathiolan-4-yl) N-amino-N-(benzenesulfonyl)carbamate |
| SMILES | NN(C(=O)OC1COS(=O)(=O)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O7S2/c11-12(21(16,17)9-4-2-1-3-5-9)10(13)19-8-6-18-20(14,15)7-8/h1-5,8H,6-7,11H2 |
| InChIKey | KGFKBIATEGSCRV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|