About (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate
(3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate (PubChem CID 167046285) has the molecular formula C12H14N2O5S
and a molecular weight of 298.32 g/mol. Its IUPAC name is (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate.
Molecular Properties
| Compound Name | (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate |
| PubChem CID | 167046285 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate |
| SMILES | NN(C(=O)OC1CCC(=O)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O5S/c13-14(12(16)19-10-7-6-9(15)8-10)20(17,18)11-4-2-1-3-5-11/h1-5,10H,6-8,13H2 |
| InChIKey | JSYKLNGDEPNYKF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate?
The IUPAC name of (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate (CID 167046285) is (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate.
What is the SMILES notation for (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate?
The canonical SMILES for (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate is NN(C(=O)OC1CCC(=O)C1)S(=O)(=O)c1ccccc1.
What is the InChIKey of (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate?
The InChIKey is JSYKLNGDEPNYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5S/c13-14(12(16)19-10-7-6-9(15)8-10)20(17,18)11-4-2-1-3-5-11/h1-5,10H,6-8,13H2.
What are the key properties of (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate?
(3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate has a molecular weight of 298.32 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclopentyl) N-amino-N-(benzenesulfonyl)carbamate is sourced from PubChem (CID 167046285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).