About (3-oxocyclohexyl) hydrogen carbonate;styrene
(3-oxocyclohexyl) hydrogen carbonate;styrene (PubChem CID 174675684) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is (3-oxocyclohexyl) hydrogen carbonate;styrene.
Molecular Properties
| Compound Name | (3-oxocyclohexyl) hydrogen carbonate;styrene |
| PubChem CID | 174675684 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3-oxocyclohexyl) hydrogen carbonate;styrene |
| SMILES | C=Cc1ccccc1.O=C1CCCC(OC(=O)O)C1 |
| InChI | InChI=1S/C8H8.C7H10O4/c1-2-8-6-4-3-5-7-8;8-5-2-1-3-6(4-5)11-7(9)10/h2-7H,1H2;6H,1-4H2,(H,9,10) |
| InChIKey | BXCCJXDJXSUFCQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-oxocyclohexyl) hydrogen carbonate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclohexyl) hydrogen carbonate;styrene?
The IUPAC name of (3-oxocyclohexyl) hydrogen carbonate;styrene (CID 174675684) is (3-oxocyclohexyl) hydrogen carbonate;styrene.
What is the SMILES notation for (3-oxocyclohexyl) hydrogen carbonate;styrene?
The canonical SMILES for (3-oxocyclohexyl) hydrogen carbonate;styrene is C=Cc1ccccc1.O=C1CCCC(OC(=O)O)C1.
What is the InChIKey of (3-oxocyclohexyl) hydrogen carbonate;styrene?
The InChIKey is BXCCJXDJXSUFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H10O4/c1-2-8-6-4-3-5-7-8;8-5-2-1-3-6(4-5)11-7(9)10/h2-7H,1H2;6H,1-4H2,(H,9,10).
What are the key properties of (3-oxocyclohexyl) hydrogen carbonate;styrene?
(3-oxocyclohexyl) hydrogen carbonate;styrene has a molecular weight of 262.31 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclohexyl) hydrogen carbonate;styrene is sourced from PubChem (CID 174675684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).