About (2S)-pyrrolidine-2-carboxylic acid;styrene
(2S)-pyrrolidine-2-carboxylic acid;styrene (PubChem CID 175001935) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is (2S)-pyrrolidine-2-carboxylic acid;styrene.
Molecular Properties
| Compound Name | (2S)-pyrrolidine-2-carboxylic acid;styrene |
| PubChem CID | 175001935 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2S)-pyrrolidine-2-carboxylic acid;styrene |
| SMILES | C=Cc1ccccc1.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C8H8.C5H9NO2/c1-2-8-6-4-3-5-7-8;7-5(8)4-2-1-3-6-4/h2-7H,1H2;4,6H,1-3H2,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | YPTCPDLLDHKMQG-VWMHFEHESA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-pyrrolidine-2-carboxylic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-pyrrolidine-2-carboxylic acid;styrene?
The IUPAC name of (2S)-pyrrolidine-2-carboxylic acid;styrene (CID 175001935) is (2S)-pyrrolidine-2-carboxylic acid;styrene.
What is the SMILES notation for (2S)-pyrrolidine-2-carboxylic acid;styrene?
The canonical SMILES for (2S)-pyrrolidine-2-carboxylic acid;styrene is C=Cc1ccccc1.O=C(O)[C@@H]1CCCN1.
What is the InChIKey of (2S)-pyrrolidine-2-carboxylic acid;styrene?
The InChIKey is YPTCPDLLDHKMQG-VWMHFEHESA-N. The full InChI is InChI=1S/C8H8.C5H9NO2/c1-2-8-6-4-3-5-7-8;7-5(8)4-2-1-3-6-4/h2-7H,1H2;4,6H,1-3H2,(H,7,8)/t;4-/m.0/s1.
What are the key properties of (2S)-pyrrolidine-2-carboxylic acid;styrene?
(2S)-pyrrolidine-2-carboxylic acid;styrene has a molecular weight of 219.28 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-pyrrolidine-2-carboxylic acid;styrene is sourced from PubChem (CID 175001935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).