C13H16O6S — CID 2331696
[(3R)-1,1-dioxothiolan-3-yl] 2-(3-methoxyphenoxy)acetate (PubChem CID 2331696) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is [(3R)-1,1-dioxothiolan-3-yl] 2-(3-methoxyphenoxy)acetate.
| Compound Name | [(3R)-1,1-dioxothiolan-3-yl] 2-(3-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 2331696 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [(3R)-1,1-dioxothiolan-3-yl] 2-(3-methoxyphenoxy)acetate |
| SMILES | COc1cccc(OCC(=O)O[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H16O6S/c1-17-10-3-2-4-11(7-10)18-8-13(14)19-12-5-6-20(15,16)9-12/h2-4,7,12H,5-6,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | PLEWHCYXJJUKEP-GFCCVEGCSA-N |
| XLogP | 0.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |