C19H20O — CID 67859369
1,2-bis(ethenyl)benzene;2-phenylprop-2-en-1-ol (PubChem CID 67859369) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-phenylprop-2-en-1-ol.
| Compound Name | 1,2-bis(ethenyl)benzene;2-phenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 67859369 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-phenylprop-2-en-1-ol |
| SMILES | C=C(CO)c1ccccc1.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C9H10O/c1-3-9-7-5-6-8-10(9)4-2;1-8(7-10)9-5-3-2-4-6-9/h3-8H,1-2H2;2-6,10H,1,7H2 |
| InChIKey | OVOBQYLLYVMDPG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |