C6H6Br2S — CID 174416053
3-(2,2-dibromoethyl)thiophene (PubChem CID 174416053) has the molecular formula C6H6Br2S and a molecular weight of 269.99 g/mol. Its IUPAC name is 3-(2,2-dibromoethyl)thiophene.
| Compound Name | 3-(2,2-dibromoethyl)thiophene |
|---|---|
| PubChem CID | 174416053 |
| Molecular Formula | C6H6Br2S |
| Molecular Weight | 269.99 g/mol |
| Exact Mass | 267.86 |
| IUPAC Name | 3-(2,2-dibromoethyl)thiophene |
| SMILES | BrC(Br)Cc1ccsc1 |
| InChI | InChI=1S/C6H6Br2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4,6H,3H2 |
| InChIKey | OIMGUUGAFYIPRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.99 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|