C12H18OS3 — CID 103345099
1-(5,6-dimethyl-1,4-dithian-2-yl)-2-thiophen-3-ylethanol (PubChem CID 103345099) has the molecular formula C12H18OS3 and a molecular weight of 274.48 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,4-dithian-2-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103345099 |
| Molecular Formula | C12H18OS3 |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)-2-thiophen-3-ylethanol |
| SMILES | CC1SCC(C(O)Cc2ccsc2)SC1C |
| InChI | InChI=1S/C12H18OS3/c1-8-9(2)16-12(7-15-8)11(13)5-10-3-4-14-6-10/h3-4,6,8-9,11-13H,5,7H2,1-2H3 |
| InChIKey | NQZJUCAOZJDSEJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |