C13H24O — CID 103277568
1-(3,5-dimethylcyclohex-3-en-1-yl)pentan-1-ol (PubChem CID 103277568) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)pentan-1-ol.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 103277568 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)pentan-1-ol |
| SMILES | CCCCC(O)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C13H24O/c1-4-5-6-13(14)12-8-10(2)7-11(3)9-12/h7,10,12-14H,4-6,8-9H2,1-3H3 |
| InChIKey | QRTJLDXKBIJBGK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|