C16H29NO3S — CID 103277705
1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol (PubChem CID 103277705) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
|---|---|
| PubChem CID | 103277705 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
| SMILES | CC1=CC(C)CC(C(O)CC2CCCN(S(C)(=O)=O)C2)C1 |
| InChI | InChI=1S/C16H29NO3S/c1-12-7-13(2)9-15(8-12)16(18)10-14-5-4-6-17(11-14)21(3,19)20/h7,12,14-16,18H,4-6,8-11H2,1-3H3 |
| InChIKey | WMHJUUBCSKLDSJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|