C14H19Cl2NO3S — CID 79609528
1-(3,5-dichlorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol (PubChem CID 79609528) has the molecular formula C14H19Cl2NO3S and a molecular weight of 352.28 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
|---|---|
| PubChem CID | 79609528 |
| Molecular Formula | C14H19Cl2NO3S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
| SMILES | CS(=O)(=O)N1CCCC(CC(O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H19Cl2NO3S/c1-21(19,20)17-4-2-3-10(9-17)5-14(18)11-6-12(15)8-13(16)7-11/h6-8,10,14,18H,2-5,9H2,1H3 |
| InChIKey | AECJSQYHKZLOSV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |