C12H18ClNO4S — CID 106693883
1-(5-chlorofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol (PubChem CID 106693883) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol.
| Compound Name | 1-(5-chlorofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
|---|---|
| PubChem CID | 106693883 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
| SMILES | CS(=O)(=O)N1CCCC(CC(O)c2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C12H18ClNO4S/c1-19(16,17)14-6-2-3-9(8-14)7-10(15)11-4-5-12(13)18-11/h4-5,9-10,15H,2-3,6-8H2,1H3 |
| InChIKey | JGFKOSTVYHJMFO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |