C14H20INO3S — CID 115820325
1-(2-iodophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol (PubChem CID 115820325) has the molecular formula C14H20INO3S and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-(2-iodophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol.
| Compound Name | 1-(2-iodophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
|---|---|
| PubChem CID | 115820325 |
| Molecular Formula | C14H20INO3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 1-(2-iodophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
| SMILES | CS(=O)(=O)N1CCCC(CC(O)c2ccccc2I)C1 |
| InChI | InChI=1S/C14H20INO3S/c1-20(18,19)16-8-4-5-11(10-16)9-14(17)12-6-2-3-7-13(12)15/h2-3,6-7,11,14,17H,4-5,8-10H2,1H3 |
| InChIKey | QUGGRERHURVCQJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|