C14H24N4O2S — CID 105223840
2-[1-hydrazinyl-2-(1-methylsulfonylpiperidin-3-yl)ethyl]aniline (PubChem CID 105223840) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[1-hydrazinyl-2-(1-methylsulfonylpiperidin-3-yl)ethyl]aniline.
| Compound Name | 2-[1-hydrazinyl-2-(1-methylsulfonylpiperidin-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 105223840 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[1-hydrazinyl-2-(1-methylsulfonylpiperidin-3-yl)ethyl]aniline |
| SMILES | CS(=O)(=O)N1CCCC(CC(NN)c2ccccc2N)C1 |
| InChI | InChI=1S/C14H24N4O2S/c1-21(19,20)18-8-4-5-11(10-18)9-14(17-16)12-6-2-3-7-13(12)15/h2-3,6-7,11,14,17H,4-5,8-10,15-16H2,1H3 |
| InChIKey | RCDUNQQJZKYPBX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|