C12H20ClN3O3S — CID 106694587
[1-(2-chlorofuran-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine (PubChem CID 106694587) has the molecular formula C12H20ClN3O3S and a molecular weight of 321.83 g/mol. Its IUPAC name is [1-(2-chlorofuran-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2-chlorofuran-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106694587 |
| Molecular Formula | C12H20ClN3O3S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [1-(2-chlorofuran-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
| SMILES | CS(=O)(=O)N1CCCC(CC(NN)c2ccoc2Cl)C1 |
| InChI | InChI=1S/C12H20ClN3O3S/c1-20(17,18)16-5-2-3-9(8-16)7-11(15-14)10-4-6-19-12(10)13/h4,6,9,11,15H,2-3,5,7-8,14H2,1H3 |
| InChIKey | FZQNXGASWYXOFZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|