C12H23N5O2S — CID 105228709
[1-(1-methylpyrazol-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine (PubChem CID 105228709) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is [1-(1-methylpyrazol-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1-methylpyrazol-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105228709 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [1-(1-methylpyrazol-3-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
| SMILES | Cn1ccc(C(CC2CCCN(S(C)(=O)=O)C2)NN)n1 |
| InChI | InChI=1S/C12H23N5O2S/c1-16-7-5-11(15-16)12(14-13)8-10-4-3-6-17(9-10)20(2,18)19/h5,7,10,12,14H,3-4,6,8-9,13H2,1-2H3 |
| InChIKey | XNVOJYWFHFCEJT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|