C13H23N3O3S2 — CID 105322822
[1-(3-methoxythiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine (PubChem CID 105322822) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is [1-(3-methoxythiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine.
| Compound Name | [1-(3-methoxythiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105322822 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [1-(3-methoxythiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethyl]hydrazine |
| SMILES | COc1ccsc1C(CC1CCCN(S(C)(=O)=O)C1)NN |
| InChI | InChI=1S/C13H23N3O3S2/c1-19-12-5-7-20-13(12)11(15-14)8-10-4-3-6-16(9-10)21(2,17)18/h5,7,10-11,15H,3-4,6,8-9,14H2,1-2H3 |
| InChIKey | IWMMCTBFHRLLJS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|