C12H19NO3S2 — CID 79612108
2-(1-methylsulfonylpiperidin-3-yl)-1-thiophen-2-ylethanol (PubChem CID 79612108) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(1-methylsulfonylpiperidin-3-yl)-1-thiophen-2-ylethanol.
| Compound Name | 2-(1-methylsulfonylpiperidin-3-yl)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 79612108 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-(1-methylsulfonylpiperidin-3-yl)-1-thiophen-2-ylethanol |
| SMILES | CS(=O)(=O)N1CCCC(CC(O)c2cccs2)C1 |
| InChI | InChI=1S/C12H19NO3S2/c1-18(15,16)13-6-2-4-10(9-13)8-11(14)12-5-3-7-17-12/h3,5,7,10-11,14H,2,4,6,8-9H2,1H3 |
| InChIKey | RRHBPDINIZUGLX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |