C12H18ClNO3S2 — CID 79609288
1-(4-chlorothiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol (PubChem CID 79609288) has the molecular formula C12H18ClNO3S2 and a molecular weight of 323.87 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol.
| Compound Name | 1-(4-chlorothiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
|---|---|
| PubChem CID | 79609288 |
| Molecular Formula | C12H18ClNO3S2 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanol |
| SMILES | CS(=O)(=O)N1CCCC(CC(O)c2cc(Cl)cs2)C1 |
| InChI | InChI=1S/C12H18ClNO3S2/c1-19(16,17)14-4-2-3-9(7-14)5-11(15)12-6-10(13)8-18-12/h6,8-9,11,15H,2-5,7H2,1H3 |
| InChIKey | PBHRBLCMGMBHNT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |