C14H23BrN2O2S2 — CID 79610527
1-(4-bromothiophen-2-yl)-N-ethyl-2-(1-methylsulfonylpiperidin-3-yl)ethanamine (PubChem CID 79610527) has the molecular formula C14H23BrN2O2S2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-ethyl-2-(1-methylsulfonylpiperidin-3-yl)ethanamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-ethyl-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 79610527 |
| Molecular Formula | C14H23BrN2O2S2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-ethyl-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
| SMILES | CCNC(CC1CCCN(S(C)(=O)=O)C1)c1cc(Br)cs1 |
| InChI | InChI=1S/C14H23BrN2O2S2/c1-3-16-13(14-8-12(15)10-20-14)7-11-5-4-6-17(9-11)21(2,18)19/h8,10-11,13,16H,3-7,9H2,1-2H3 |
| InChIKey | DWASBBYAXASJDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |