C12H19BrN2O3S — CID 105011114
1-(5-bromofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine (PubChem CID 105011114) has the molecular formula C12H19BrN2O3S and a molecular weight of 351.27 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine.
| Compound Name | 1-(5-bromofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 105011114 |
| Molecular Formula | C12H19BrN2O3S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
| SMILES | CS(=O)(=O)N1CCCC(CC(N)c2ccc(Br)o2)C1 |
| InChI | InChI=1S/C12H19BrN2O3S/c1-19(16,17)15-6-2-3-9(8-15)7-10(14)11-4-5-12(13)18-11/h4-5,9-10H,2-3,6-8,14H2,1H3 |
| InChIKey | XMZIJFLWKOVAFJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |