C14H20F2N2O2S — CID 79612441
1-(2,5-difluorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine (PubChem CID 79612441) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine.
| Compound Name | 1-(2,5-difluorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 79612441 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(1-methylsulfonylpiperidin-3-yl)ethanamine |
| SMILES | CS(=O)(=O)N1CCCC(CC(N)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-21(19,20)18-6-2-3-10(9-18)7-14(17)12-8-11(15)4-5-13(12)16/h4-5,8,10,14H,2-3,6-7,9,17H2,1H3 |
| InChIKey | QNWFMRSSOYNYGW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |