C13H18O2 — CID 103277555
(3,5-dimethylcyclohex-3-en-1-yl)-(furan-3-yl)methanol (PubChem CID 103277555) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3,5-dimethylcyclohex-3-en-1-yl)-(furan-3-yl)methanol.
| Compound Name | (3,5-dimethylcyclohex-3-en-1-yl)-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 103277555 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3,5-dimethylcyclohex-3-en-1-yl)-(furan-3-yl)methanol |
| SMILES | CC1=CC(C)CC(C(O)c2ccoc2)C1 |
| InChI | InChI=1S/C13H18O2/c1-9-5-10(2)7-12(6-9)13(14)11-3-4-15-8-11/h3-5,8-9,12-14H,6-7H2,1-2H3 |
| InChIKey | XIYHNDRHLCFFMX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|