C16H21ClO — CID 107559711
(3-chloro-4-methylphenyl)-(3,5-dimethylcyclohex-3-en-1-yl)methanol (PubChem CID 107559711) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-(3,5-dimethylcyclohex-3-en-1-yl)methanol.
| Compound Name | (3-chloro-4-methylphenyl)-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
|---|---|
| PubChem CID | 107559711 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (3-chloro-4-methylphenyl)-(3,5-dimethylcyclohex-3-en-1-yl)methanol |
| SMILES | CC1=CC(C)CC(C(O)c2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H21ClO/c1-10-6-11(2)8-14(7-10)16(18)13-5-4-12(3)15(17)9-13/h4-6,9-10,14,16,18H,7-8H2,1-3H3 |
| InChIKey | FPFMWBAXNURTRJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|