C17H25NO2 — CID 103277657
(3,5-dimethylcyclohex-3-en-1-yl)-(5-propan-2-yloxy-3-pyridinyl)methanol (PubChem CID 103277657) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (3,5-dimethylcyclohex-3-en-1-yl)-(5-propan-2-yloxy-3-pyridinyl)methanol.
| Compound Name | (3,5-dimethylcyclohex-3-en-1-yl)-(5-propan-2-yloxy-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 103277657 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (3,5-dimethylcyclohex-3-en-1-yl)-(5-propan-2-yloxy-3-pyridinyl)methanol |
| SMILES | CC1=CC(C)CC(C(O)c2cncc(OC(C)C)c2)C1 |
| InChI | InChI=1S/C17H25NO2/c1-11(2)20-16-8-15(9-18-10-16)17(19)14-6-12(3)5-13(4)7-14/h5,8-12,14,17,19H,6-7H2,1-4H3 |
| InChIKey | GVJPYJLZRQPVEI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|