C15H24N2O2 — CID 103277409
(3,5-dimethylcyclohex-3-en-1-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol (PubChem CID 103277409) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3,5-dimethylcyclohex-3-en-1-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol.
| Compound Name | (3,5-dimethylcyclohex-3-en-1-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 103277409 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (3,5-dimethylcyclohex-3-en-1-yl)-(1-ethyl-4-methoxypyrazol-5-yl)methanol |
| SMILES | CCn1ncc(OC)c1C(O)C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-5-17-14(13(19-4)9-16-17)15(18)12-7-10(2)6-11(3)8-12/h6,9-10,12,15,18H,5,7-8H2,1-4H3 |
| InChIKey | CGUNYGNNYXEWAU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|