C10H18N2O4 — CID 114636558
1-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethoxyethanol (PubChem CID 114636558) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethoxyethanol.
| Compound Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 114636558 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(1-ethyl-4-methoxypyrazol-5-yl)-2,2-dimethoxyethanol |
| SMILES | CCn1ncc(OC)c1C(O)C(OC)OC |
| InChI | InChI=1S/C10H18N2O4/c1-5-12-8(7(14-2)6-11-12)9(13)10(15-3)16-4/h6,9-10,13H,5H2,1-4H3 |
| InChIKey | WIGAKHQQIVVWBS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|