C10H19N3O2 — CID 114644642
2-(dimethylamino)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol (PubChem CID 114644642) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol.
| Compound Name | 2-(dimethylamino)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 114644642 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(dimethylamino)-1-(1-ethyl-4-methoxypyrazol-5-yl)ethanol |
| SMILES | CCn1ncc(OC)c1C(O)CN(C)C |
| InChI | InChI=1S/C10H19N3O2/c1-5-13-10(8(14)7-12(2)3)9(15-4)6-11-13/h6,8,14H,5,7H2,1-4H3 |
| InChIKey | QKTBASLWKJIQTE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |