C14H18Cl2OS2 — CID 115386317
2-(2,4-dichlorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol (PubChem CID 115386317) has the molecular formula C14H18Cl2OS2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 115386317 |
| Molecular Formula | C14H18Cl2OS2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol |
| SMILES | CCC1SCCSC1C(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2OS2/c1-2-13-14(19-6-5-18-13)12(17)7-9-3-4-10(15)8-11(9)16/h3-4,8,12-14,17H,2,5-7H2,1H3 |
| InChIKey | ONPUZTSDOUQPSC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |