C14H22ClNOS — CID 107359569
(3-chlorothiophen-2-yl)-[1-(dimethylamino)-4-methylcyclohexyl]methanol (PubChem CID 107359569) has the molecular formula C14H22ClNOS and a molecular weight of 287.86 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-[1-(dimethylamino)-4-methylcyclohexyl]methanol.
| Compound Name | (3-chlorothiophen-2-yl)-[1-(dimethylamino)-4-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 107359569 |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (3-chlorothiophen-2-yl)-[1-(dimethylamino)-4-methylcyclohexyl]methanol |
| SMILES | CC1CCC(C(O)c2sccc2Cl)(N(C)C)CC1 |
| InChI | InChI=1S/C14H22ClNOS/c1-10-4-7-14(8-5-10,16(2)3)13(17)12-11(15)6-9-18-12/h6,9-10,13,17H,4-5,7-8H2,1-3H3 |
| InChIKey | RAUYKYYHLWMVQF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |