C12H17BrO2S — CID 103451994
1-[(3-bromothiophen-2-yl)-hydroxymethyl]cycloheptan-1-ol (PubChem CID 103451994) has the molecular formula C12H17BrO2S and a molecular weight of 305.24 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)-hydroxymethyl]cycloheptan-1-ol.
| Compound Name | 1-[(3-bromothiophen-2-yl)-hydroxymethyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 103451994 |
| Molecular Formula | C12H17BrO2S |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)-hydroxymethyl]cycloheptan-1-ol |
| SMILES | OC(c1sccc1Br)C1(O)CCCCCC1 |
| InChI | InChI=1S/C12H17BrO2S/c13-9-5-8-16-10(9)11(14)12(15)6-3-1-2-4-7-12/h5,8,11,14-15H,1-4,6-7H2 |
| InChIKey | KBHSFZORTYLFEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |